C21H16ClN3O2 — CID 118737002
methyl 4-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene-7-carboxylate chloride (PubChem CID 118737002) has the molecular formula C21H16ClN3O2 and a molecular weight of 377.83 g/mol. Its IUPAC name is methyl 4-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene-7-carboxylate chloride.
| Compound Name | methyl 4-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene-7-carboxylate chloride |
|---|---|
| PubChem CID | 118737002 |
| Molecular Formula | C21H16ClN3O2 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 4-phenyl-4,16-diaza-6-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,7,10,12,14-heptaene-7-carboxylate chloride |
| SMILES | COC(=O)c1cc2c3ccccc3[nH]c2c2cn(-c3ccccc3)c[n+]12.[Cl-] |
| InChI | InChI=1S/C21H15N3O2.ClH/c1-26-21(25)18-11-16-15-9-5-6-10-17(15)22-20(16)19-12-23(13-24(18)19)14-7-3-2-4-8-14;/h2-13H,1H3;1H |
| InChIKey | PTEVZWHYYGZWCO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 51.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|