C23H20N3O2+ — CID 118737033
methyl 4-[(4-methylphenyl)methyl]-6,16-diaza-4-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10,12,14-heptaene-7-carboxylate (PubChem CID 118737033) has the molecular formula C23H20N3O2+ and a molecular weight of 370.43 g/mol. Its IUPAC name is methyl 4-[(4-methylphenyl)methyl]-6,16-diaza-4-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10,12,14-heptaene-7-carboxylate.
| Compound Name | methyl 4-[(4-methylphenyl)methyl]-6,16-diaza-4-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10,12,14-heptaene-7-carboxylate |
|---|---|
| PubChem CID | 118737033 |
| Molecular Formula | C23H20N3O2+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | methyl 4-[(4-methylphenyl)methyl]-6,16-diaza-4-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10,12,14-heptaene-7-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3[nH]c2c2c[n+](Cc3ccc(C)cc3)cn12 |
| InChI | InChI=1S/C23H19N3O2/c1-15-7-9-16(10-8-15)12-25-13-21-22-18(17-5-3-4-6-19(17)24-22)11-20(23(27)28-2)26(21)14-25/h3-11,13-14H,12H2,1-2H3/p+1 |
| InChIKey | KEENENHAYJJWCH-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|