About 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine
4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine (PubChem CID 118737087) has the molecular formula C21H19BrN4O2S
and a molecular weight of 471.38 g/mol. Its IUPAC name is 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine |
| PubChem CID | 118737087 |
| Molecular Formula | C21H19BrN4O2S |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cc(-c3ccnc(N)n3)c3cc(Br)ccc32)c(C)c1 |
| InChI | InChI=1S/C21H19BrN4O2S/c1-12-8-13(2)20(14(3)9-12)29(27,28)26-11-17(18-6-7-24-21(23)25-18)16-10-15(22)4-5-19(16)26/h4-11H,1-3H3,(H2,23,24,25) |
| InChIKey | NGQKBDMVRNMQFJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine?
The IUPAC name of 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine (CID 118737087) is 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine?
The canonical SMILES for 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine is Cc1cc(C)c(S(=O)(=O)n2cc(-c3ccnc(N)n3)c3cc(Br)ccc32)c(C)c1.
What is the InChIKey of 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine?
The InChIKey is NGQKBDMVRNMQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19BrN4O2S/c1-12-8-13(2)20(14(3)9-12)29(27,28)26-11-17(18-6-7-24-21(23)25-18)16-10-15(22)4-5-19(16)26/h4-11H,1-3H3,(H2,23,24,25).
What are the key properties of 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine?
4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine has a molecular weight of 471.38 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-bromo-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]pyrimidin-2-amine is sourced from PubChem (CID 118737087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).