C25H23NO5S — CID 118737148
3-(3-naphthalen-1-yloxypropyl)-9,9-dioxo-9λ6-thia-1-azatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-2-carboxylic acid (PubChem CID 118737148) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-(3-naphthalen-1-yloxypropyl)-9,9-dioxo-9λ6-thia-1-azatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-2-carboxylic acid.
| Compound Name | 3-(3-naphthalen-1-yloxypropyl)-9,9-dioxo-9λ6-thia-1-azatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-2-carboxylic acid |
|---|---|
| PubChem CID | 118737148 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 3-(3-naphthalen-1-yloxypropyl)-9,9-dioxo-9λ6-thia-1-azatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-2-carboxylic acid |
| SMILES | O=C(O)c1c(CCCOc2cccc3ccccc23)c2cccc3c2n1CCCS3(=O)=O |
| InChI | InChI=1S/C25H23NO5S/c27-25(28)24-20(11-5-15-31-21-12-3-8-17-7-1-2-9-18(17)21)19-10-4-13-22-23(19)26(24)14-6-16-32(22,29)30/h1-4,7-10,12-13H,5-6,11,14-16H2,(H,27,28) |
| InChIKey | BTBUZFMVFUFDSU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|