C37H51N7O7S — CID 118737159
7-[5-[[4-[4-(dimethylsulfamoyl)piperazin-1-yl]phenoxy]methyl]-1,3-dimethylpyrazol-4-yl]-3-(3-methoxypropyl)-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid (PubChem CID 118737159) has the molecular formula C37H51N7O7S and a molecular weight of 737.92 g/mol. Its IUPAC name is 7-[5-[[4-[4-(dimethylsulfamoyl)piperazin-1-yl]phenoxy]methyl]-1,3-dimethylpyrazol-4-yl]-3-(3-methoxypropyl)-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid.
| Compound Name | 7-[5-[[4-[4-(dimethylsulfamoyl)piperazin-1-yl]phenoxy]methyl]-1,3-dimethylpyrazol-4-yl]-3-(3-methoxypropyl)-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 118737159 |
| Molecular Formula | C37H51N7O7S |
| Molecular Weight | 737.92 g/mol |
| Exact Mass | 737.36 |
| IUPAC Name | 7-[5-[[4-[4-(dimethylsulfamoyl)piperazin-1-yl]phenoxy]methyl]-1,3-dimethylpyrazol-4-yl]-3-(3-methoxypropyl)-1-(2-morpholin-4-ylethyl)indole-2-carboxylic acid |
| SMILES | COCCCc1c(C(=O)O)n(CCN2CCOCC2)c2c(-c3c(C)nn(C)c3COc3ccc(N4CCN(S(=O)(=O)N(C)C)CC4)cc3)cccc12 |
| InChI | InChI=1S/C37H51N7O7S/c1-27-34(33(40(4)38-27)26-51-29-13-11-28(12-14-29)42-16-18-43(19-17-42)52(47,48)39(2)3)32-9-6-8-30-31(10-7-23-49-5)36(37(45)46)44(35(30)32)20-15-41-21-24-50-25-22-41/h6,8-9,11-14H,7,10,15-26H2,1-5H3,(H,45,46) |
| InChIKey | NXIRNRIXHFBWOT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.92 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|