C36H42O6 — CID 118737210
[(1R,3E,5R,7S,11R,12R,13S,14S)-1-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-11-(2-phenylacetyl)oxy-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] 2-phenylacetate (PubChem CID 118737210) has the molecular formula C36H42O6 and a molecular weight of 570.73 g/mol. Its IUPAC name is [(1R,3E,5R,7S,11R,12R,13S,14S)-1-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-11-(2-phenylacetyl)oxy-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] 2-phenylacetate.
| Compound Name | [(1R,3E,5R,7S,11R,12R,13S,14S)-1-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-11-(2-phenylacetyl)oxy-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] 2-phenylacetate |
|---|---|
| PubChem CID | 118737210 |
| Molecular Formula | C36H42O6 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | [(1R,3E,5R,7S,11R,12R,13S,14S)-1-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-11-(2-phenylacetyl)oxy-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] 2-phenylacetate |
| SMILES | C=C1CC[C@H]2[C@@H](/C=C(\C)C(=O)[C@@]3(O)C[C@H](C)[C@H](OC(=O)Cc4ccccc4)[C@@H]3[C@H]1OC(=O)Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C36H42O6/c1-22-16-17-27-28(35(27,4)5)18-23(2)34(39)36(40)21-24(3)33(42-30(38)20-26-14-10-7-11-15-26)31(36)32(22)41-29(37)19-25-12-8-6-9-13-25/h6-15,18,24,27-28,31-33,40H,1,16-17,19-21H2,2-5H3/b23-18+/t24-,27-,28+,31-,32-,33-,36+/m0/s1 |
| InChIKey | QNLAWXBDHBVLPK-WSFLWUFGSA-N |
| XLogP | 5.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|