C31H40O6 — CID 118737214
[(1R,3E,5R,7S,11R,12R,13S,14S)-1-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-11-(2-phenylacetyl)oxy-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] propanoate (PubChem CID 118737214) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is [(1R,3E,5R,7S,11R,12R,13S,14S)-1-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-11-(2-phenylacetyl)oxy-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] propanoate.
| Compound Name | [(1R,3E,5R,7S,11R,12R,13S,14S)-1-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-11-(2-phenylacetyl)oxy-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] propanoate |
|---|---|
| PubChem CID | 118737214 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | [(1R,3E,5R,7S,11R,12R,13S,14S)-1-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-11-(2-phenylacetyl)oxy-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] propanoate |
| SMILES | C=C1CC[C@H]2[C@@H](/C=C(\C)C(=O)[C@@]3(O)C[C@H](C)[C@H](OC(=O)CC)[C@@H]3[C@H]1OC(=O)Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C31H40O6/c1-7-24(32)36-28-20(4)17-31(35)26(28)27(37-25(33)16-21-11-9-8-10-12-21)18(2)13-14-22-23(30(22,5)6)15-19(3)29(31)34/h8-12,15,20,22-23,26-28,35H,2,7,13-14,16-17H2,1,3-6H3/b19-15+/t20-,22-,23+,26-,27-,28-,31+/m0/s1 |
| InChIKey | SALMAXRXMSBKQG-HFVPVWBUSA-N |
| XLogP | 4.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|