C24H34O6 — CID 118737222
[(1S,3S,4S,5R,6R,10S,12R,13S,14S)-6-acetyloxy-3,11,11,14-tetramethyl-7-methylidene-15-oxo-16-oxatetracyclo[11.2.1.01,5.010,12]hexadecan-4-yl] acetate (PubChem CID 118737222) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(1S,3S,4S,5R,6R,10S,12R,13S,14S)-6-acetyloxy-3,11,11,14-tetramethyl-7-methylidene-15-oxo-16-oxatetracyclo[11.2.1.01,5.010,12]hexadecan-4-yl] acetate.
| Compound Name | [(1S,3S,4S,5R,6R,10S,12R,13S,14S)-6-acetyloxy-3,11,11,14-tetramethyl-7-methylidene-15-oxo-16-oxatetracyclo[11.2.1.01,5.010,12]hexadecan-4-yl] acetate |
|---|---|
| PubChem CID | 118737222 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [(1S,3S,4S,5R,6R,10S,12R,13S,14S)-6-acetyloxy-3,11,11,14-tetramethyl-7-methylidene-15-oxo-16-oxatetracyclo[11.2.1.01,5.010,12]hexadecan-4-yl] acetate |
| SMILES | C=C1CC[C@H]2[C@@H]([C@@H]3O[C@]4(C[C@H](C)[C@H](OC(C)=O)[C@@H]4[C@H]1OC(C)=O)C(=O)[C@H]3C)C2(C)C |
| InChI | InChI=1S/C24H34O6/c1-11-8-9-16-17(23(16,6)7)21-13(3)22(27)24(30-21)10-12(2)20(29-15(5)26)18(24)19(11)28-14(4)25/h12-13,16-21H,1,8-10H2,2-7H3/t12-,13-,16-,17-,18-,19-,20-,21+,24-/m0/s1 |
| InChIKey | FYOOSCHMWUGTQG-CUNPXZAYSA-N |
| XLogP | 3.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|