C20H28O3 — CID 118737232
(1R,4S,5R,9R,13S)-13-hydroxy-5-(hydroxymethyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-10-en-15-one (PubChem CID 118737232) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,4S,5R,9R,13S)-13-hydroxy-5-(hydroxymethyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-10-en-15-one.
| Compound Name | (1R,4S,5R,9R,13S)-13-hydroxy-5-(hydroxymethyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-10-en-15-one |
|---|---|
| PubChem CID | 118737232 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,4S,5R,9R,13S)-13-hydroxy-5-(hydroxymethyl)-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-10-en-15-one |
| SMILES | C=C1C(=O)[C@@]23CC[C@@H]4[C@](C)(CO)CCC[C@@]4(C)C2=CC[C@]1(O)C3 |
| InChI | InChI=1S/C20H28O3/c1-13-16(22)19-9-5-14-17(2,12-21)7-4-8-18(14,3)15(19)6-10-20(13,23)11-19/h6,14,21,23H,1,4-5,7-12H2,2-3H3/t14-,17+,18-,19-,20+/m1/s1 |
| InChIKey | HCZYQWZXOMCLRO-JBCQCRMPSA-N |
| XLogP | 3.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|