About 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile
2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile (PubChem CID 118737279) has the molecular formula C9H5NO3S
and a molecular weight of 207.21 g/mol. Its IUPAC name is 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile.
Molecular Properties
| Compound Name | 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile |
| PubChem CID | 118737279 |
| Molecular Formula | C9H5NO3S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C=CS(=O)(=O)O2 |
| InChI | InChI=1S/C9H5NO3S/c10-6-7-1-2-9-8(5-7)3-4-14(11,12)13-9/h1-5H |
| InChIKey | DRNUHNOZFFNRAW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile?
The IUPAC name of 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile (CID 118737279) is 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile.
What is the SMILES notation for 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile?
The canonical SMILES for 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile is N#Cc1ccc2c(c1)C=CS(=O)(=O)O2.
What is the InChIKey of 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile?
The InChIKey is DRNUHNOZFFNRAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO3S/c10-6-7-1-2-9-8(5-7)3-4-14(11,12)13-9/h1-5H.
What are the key properties of 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile?
2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile has a molecular weight of 207.21 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dioxo-1,2λ6-benzoxathiine-6-carbonitrile is sourced from PubChem (CID 118737279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).