C20H25N5O3 — CID 118737301
N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]acetamide (PubChem CID 118737301) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 118737301 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]acetamide |
| SMILES | COc1ccc(-c2c(C)nn3c(NCCNC(C)=O)cc(C)nc23)cc1OC |
| InChI | InChI=1S/C20H25N5O3/c1-12-10-18(22-9-8-21-14(3)26)25-20(23-12)19(13(2)24-25)15-6-7-16(27-4)17(11-15)28-5/h6-7,10-11,22H,8-9H2,1-5H3,(H,21,26) |
| InChIKey | FZPVOGSJCDLHJM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|