C22H29N5O3 — CID 118737302
N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylpropanamide (PubChem CID 118737302) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 118737302 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-methylpropanamide |
| SMILES | COc1ccc(-c2c(C)nn3c(NCCNC(=O)C(C)C)cc(C)nc23)cc1OC |
| InChI | InChI=1S/C22H29N5O3/c1-13(2)22(28)24-10-9-23-19-11-14(3)25-21-20(15(4)26-27(19)21)16-7-8-17(29-5)18(12-16)30-6/h7-8,11-13,23H,9-10H2,1-6H3,(H,24,28) |
| InChIKey | DNJZVYYJYOBRHR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|