C19H25N5O4S — CID 118737303
N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]methanesulfonamide (PubChem CID 118737303) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 118737303 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[2-[[3-(3,4-dimethoxyphenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]methanesulfonamide |
| SMILES | COc1ccc(-c2c(C)nn3c(NCCNS(C)(=O)=O)cc(C)nc23)cc1OC |
| InChI | InChI=1S/C19H25N5O4S/c1-12-10-17(20-8-9-21-29(5,25)26)24-19(22-12)18(13(2)23-24)14-6-7-15(27-3)16(11-14)28-4/h6-7,10-11,20-21H,8-9H2,1-5H3 |
| InChIKey | KBKJZURSVLNLLH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|