About 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine
3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine (PubChem CID 118737305) has the molecular formula C21H27N5O3
and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine |
| PubChem CID | 118737305 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine |
| SMILES | COc1ccc(-c2c(C)nc3c(NCCN4CCOCC4)ccnn23)cc1OC |
| InChI | InChI=1S/C21H27N5O3/c1-15-20(16-4-5-18(27-2)19(14-16)28-3)26-21(24-15)17(6-7-23-26)22-8-9-25-10-12-29-13-11-25/h4-7,14,22H,8-13H2,1-3H3 |
| InChIKey | CFLABOGUXKYRSK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine (CID 118737305) is 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine is COc1ccc(-c2c(C)nc3c(NCCN4CCOCC4)ccnn23)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine?
The InChIKey is CFLABOGUXKYRSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N5O3/c1-15-20(16-4-5-18(27-2)19(14-16)28-3)26-21(24-15)17(6-7-23-26)22-8-9-25-10-12-29-13-11-25/h4-7,14,22H,8-13H2,1-3H3.
What are the key properties of 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine?
3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine has a molecular weight of 397.48 g/mol, XLogP of 2.47, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-2-methyl-N-(2-morpholin-4-ylethyl)imidazo[1,2-b]pyridazin-8-amine is sourced from PubChem (CID 118737305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).