About 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine
9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine (PubChem CID 118737376) has the molecular formula C15H15Cl2N5S
and a molecular weight of 368.29 g/mol. Its IUPAC name is 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine.
Molecular Properties
| Compound Name | 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine |
| PubChem CID | 118737376 |
| Molecular Formula | C15H15Cl2N5S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine |
| SMILES | CCCCn1c(Sc2cc(Cl)cc(Cl)c2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C15H15Cl2N5S/c1-2-3-4-22-14-12(13(18)19-8-20-14)21-15(22)23-11-6-9(16)5-10(17)7-11/h5-8H,2-4H2,1H3,(H2,18,19,20) |
| InChIKey | GYAYKIDKTVWJLI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine?
The IUPAC name of 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine (CID 118737376) is 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine.
What is the SMILES notation for 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine?
The canonical SMILES for 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine is CCCCn1c(Sc2cc(Cl)cc(Cl)c2)nc2c(N)ncnc21.
What is the InChIKey of 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine?
The InChIKey is GYAYKIDKTVWJLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2N5S/c1-2-3-4-22-14-12(13(18)19-8-20-14)21-15(22)23-11-6-9(16)5-10(17)7-11/h5-8H,2-4H2,1H3,(H2,18,19,20).
What are the key properties of 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine?
9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine has a molecular weight of 368.29 g/mol, XLogP of 4.67, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butyl-8-(3,5-dichlorophenyl)sulfanylpurin-6-amine is sourced from PubChem (CID 118737376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).