C16H21N3O7S — CID 118737401
8-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxyoctanamide (PubChem CID 118737401) has the molecular formula C16H21N3O7S and a molecular weight of 399.43 g/mol. Its IUPAC name is 8-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxyoctanamide.
| Compound Name | 8-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxyoctanamide |
|---|---|
| PubChem CID | 118737401 |
| Molecular Formula | C16H21N3O7S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 8-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxyoctanamide |
| SMILES | O=C(CCCCCCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)NO |
| InChI | InChI=1S/C16H21N3O7S/c20-14(17-21)11-7-2-1-3-8-12-25-15-16(19(22)26-18-15)27(23,24)13-9-5-4-6-10-13/h4-6,9-10,21H,1-3,7-8,11-12H2,(H,17,20) |
| InChIKey | LOJRKNRGLKUITO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 145.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|