C15H19N3O7S — CID 118737402
7-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxyheptanamide (PubChem CID 118737402) has the molecular formula C15H19N3O7S and a molecular weight of 385.40 g/mol. Its IUPAC name is 7-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxyheptanamide.
| Compound Name | 7-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 118737402 |
| Molecular Formula | C15H19N3O7S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 7-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)NO |
| InChI | InChI=1S/C15H19N3O7S/c19-13(16-20)10-6-1-2-7-11-24-14-15(18(21)25-17-14)26(22,23)12-8-4-3-5-9-12/h3-5,8-9,20H,1-2,6-7,10-11H2,(H,16,19) |
| InChIKey | VBRNWKMPAQCYLH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 145.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|