C20H22N2O4S — CID 118737480
4-(4-ethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 118737480) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-ethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 118737480 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-(4-ethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(-c2nc(N)sc2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-5-26-14-8-6-12(7-9-14)17-19(27-20(21)22-17)13-10-15(23-2)18(25-4)16(11-13)24-3/h6-11H,5H2,1-4H3,(H2,21,22) |
| InChIKey | CRPRTDCUQNTZEK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |