C21H23ClN6O — CID 118737726
3-[[3-(butylamino)-7-chloroimidazo[1,2-a]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one (PubChem CID 118737726) has the molecular formula C21H23ClN6O and a molecular weight of 410.91 g/mol. Its IUPAC name is 3-[[3-(butylamino)-7-chloroimidazo[1,2-a]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[3-(butylamino)-7-chloroimidazo[1,2-a]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 118737726 |
| Molecular Formula | C21H23ClN6O |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-[[3-(butylamino)-7-chloroimidazo[1,2-a]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one |
| SMILES | CCCCNc1c(Cn2c(=O)n(C3CC3)c3ccncc32)nc2cc(Cl)ccn12 |
| InChI | InChI=1S/C21H23ClN6O/c1-2-3-8-24-20-16(25-19-11-14(22)7-10-26(19)20)13-27-18-12-23-9-6-17(18)28(21(27)29)15-4-5-15/h6-7,9-12,15,24H,2-5,8,13H2,1H3 |
| InChIKey | PXLGFMFFLQSIHL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|