C20H24O5 — CID 118737823
(2'R,4R,5R,7aS,11aS)-5-hydroxy-2',8,9,11a-tetramethylspiro[7,7a,10,11-tetrahydro-5H-benzo[i][2]benzoxepine-4,1'-cyclopropane]-1,3,6-trione (PubChem CID 118737823) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2'R,4R,5R,7aS,11aS)-5-hydroxy-2',8,9,11a-tetramethylspiro[7,7a,10,11-tetrahydro-5H-benzo[i][2]benzoxepine-4,1'-cyclopropane]-1,3,6-trione.
| Compound Name | (2'R,4R,5R,7aS,11aS)-5-hydroxy-2',8,9,11a-tetramethylspiro[7,7a,10,11-tetrahydro-5H-benzo[i][2]benzoxepine-4,1'-cyclopropane]-1,3,6-trione |
|---|---|
| PubChem CID | 118737823 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2'R,4R,5R,7aS,11aS)-5-hydroxy-2',8,9,11a-tetramethylspiro[7,7a,10,11-tetrahydro-5H-benzo[i][2]benzoxepine-4,1'-cyclopropane]-1,3,6-trione |
| SMILES | CC1=C(C)[C@@H]2CC(=O)C3=C(C(=O)OC(=O)[C@@]4(C[C@H]4C)[C@@H]3O)[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H24O5/c1-9-5-6-19(4)12(11(9)3)7-13(21)14-15(19)17(23)25-18(24)20(16(14)22)8-10(20)2/h10,12,16,22H,5-8H2,1-4H3/t10-,12+,16-,19+,20-/m1/s1 |
| InChIKey | LZBFFUIMRBNBSD-VCQJUBLQSA-N |
| XLogP | 2.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|