C15H19N3O5S — CID 118737851
3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)-3,4-dioxocyclobuten-1-yl]-1,2-oxazole-4-sulfonamide (PubChem CID 118737851) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)-3,4-dioxocyclobuten-1-yl]-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)-3,4-dioxocyclobuten-1-yl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 118737851 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 3,5-dimethyl-N-[2-(4-methylpiperidin-1-yl)-3,4-dioxocyclobuten-1-yl]-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1c(N2CCC(C)CC2)c(=O)c1=O |
| InChI | InChI=1S/C15H19N3O5S/c1-8-4-6-18(7-5-8)12-11(13(19)14(12)20)17-24(21,22)15-9(2)16-23-10(15)3/h8,17H,4-7H2,1-3H3 |
| InChIKey | ZPOGWTAOONLGMW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|