C22H25N3O5S — CID 118737854
N-[3,4-dioxo-2-[4-(2-phenylethyl)piperidin-1-yl]cyclobuten-1-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 118737854) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[3,4-dioxo-2-[4-(2-phenylethyl)piperidin-1-yl]cyclobuten-1-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[3,4-dioxo-2-[4-(2-phenylethyl)piperidin-1-yl]cyclobuten-1-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 118737854 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[3,4-dioxo-2-[4-(2-phenylethyl)piperidin-1-yl]cyclobuten-1-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1c(N2CCC(CCc3ccccc3)CC2)c(=O)c1=O |
| InChI | InChI=1S/C22H25N3O5S/c1-14-22(15(2)30-23-14)31(28,29)24-18-19(21(27)20(18)26)25-12-10-17(11-13-25)9-8-16-6-4-3-5-7-16/h3-7,17,24H,8-13H2,1-2H3 |
| InChIKey | COTIEJKCWSNEFH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|