C26H30O6 — CID 118737872
1,4-bis(3,4-dimethoxyphenyl)-2,3-diethoxybenzene (PubChem CID 118737872) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 1,4-bis(3,4-dimethoxyphenyl)-2,3-diethoxybenzene.
| Compound Name | 1,4-bis(3,4-dimethoxyphenyl)-2,3-diethoxybenzene |
|---|---|
| PubChem CID | 118737872 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1,4-bis(3,4-dimethoxyphenyl)-2,3-diethoxybenzene |
| SMILES | CCOc1c(-c2ccc(OC)c(OC)c2)ccc(-c2ccc(OC)c(OC)c2)c1OCC |
| InChI | InChI=1S/C26H30O6/c1-7-31-25-19(17-9-13-21(27-3)23(15-17)29-5)11-12-20(26(25)32-8-2)18-10-14-22(28-4)24(16-18)30-6/h9-16H,7-8H2,1-6H3 |
| InChIKey | HQKAUQPHMWKJDE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |