C14H14FN3O — CID 118738009
3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide (PubChem CID 118738009) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 118738009 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-(4-fluorophenyl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
| SMILES | NC(=O)C1CCCc2c(-c3ccc(F)cc3)n[nH]c21 |
| InChI | InChI=1S/C14H14FN3O/c15-9-6-4-8(5-7-9)12-10-2-1-3-11(14(16)19)13(10)18-17-12/h4-7,11H,1-3H2,(H2,16,19)(H,17,18) |
| InChIKey | HOPUKNCFDKBHMU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |