C16H15N3OS — CID 118738023
3-(1-benzothiophen-3-yl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide (PubChem CID 118738023) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide.
| Compound Name | 3-(1-benzothiophen-3-yl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 118738023 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
| SMILES | NC(=O)C1CCCc2c(-c3csc4ccccc34)n[nH]c21 |
| InChI | InChI=1S/C16H15N3OS/c17-16(20)11-6-3-5-10-14(11)18-19-15(10)12-8-21-13-7-2-1-4-9(12)13/h1-2,4,7-8,11H,3,5-6H2,(H2,17,20)(H,18,19) |
| InChIKey | MIBZIYRJTYTOMY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |