C19H28N2O3 — CID 118738454
4-benzoyl-1-(2-hydroxypentyl)-6,6-dimethyl-1,4-diazepan-2-one (PubChem CID 118738454) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 4-benzoyl-1-(2-hydroxypentyl)-6,6-dimethyl-1,4-diazepan-2-one.
| Compound Name | 4-benzoyl-1-(2-hydroxypentyl)-6,6-dimethyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 118738454 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 4-benzoyl-1-(2-hydroxypentyl)-6,6-dimethyl-1,4-diazepan-2-one |
| SMILES | CCCC(O)CN1CC(C)(C)CN(C(=O)c2ccccc2)CC1=O |
| InChI | InChI=1S/C19H28N2O3/c1-4-8-16(22)11-20-13-19(2,3)14-21(12-17(20)23)18(24)15-9-6-5-7-10-15/h5-7,9-10,16,22H,4,8,11-14H2,1-3H3 |
| InChIKey | CVNIUFDEVDIDRU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |