About 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one
1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one (PubChem CID 118738466) has the molecular formula C20H30N2O3S
and a molecular weight of 378.54 g/mol. Its IUPAC name is 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one |
| PubChem CID | 118738466 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one |
| SMILES | CCCC(O)CN1CC(C)(C)CN(C(=O)c2ccc(SC)cc2)CC1=O |
| InChI | InChI=1S/C20H30N2O3S/c1-5-6-16(23)11-21-13-20(2,3)14-22(12-18(21)24)19(25)15-7-9-17(26-4)10-8-15/h7-10,16,23H,5-6,11-14H2,1-4H3 |
| InChIKey | JIGVBHCKVZBZBZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one?
The IUPAC name of 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one (CID 118738466) is 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one.
What is the SMILES notation for 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one?
The canonical SMILES for 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one is CCCC(O)CN1CC(C)(C)CN(C(=O)c2ccc(SC)cc2)CC1=O.
What is the InChIKey of 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one?
The InChIKey is JIGVBHCKVZBZBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O3S/c1-5-6-16(23)11-21-13-20(2,3)14-22(12-18(21)24)19(25)15-7-9-17(26-4)10-8-15/h7-10,16,23H,5-6,11-14H2,1-4H3.
What are the key properties of 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one?
1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one has a molecular weight of 378.54 g/mol, XLogP of 2.88, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxypentyl)-6,6-dimethyl-4-(4-methylsulfanylbenzoyl)-1,4-diazepan-2-one is sourced from PubChem (CID 118738466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).