About 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one
4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one (PubChem CID 118738549) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one |
| PubChem CID | 118738549 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one |
| SMILES | CC(C)(C)C(=O)N1CC(=O)N(Cc2ccco2)CC(O)C1 |
| InChI | InChI=1S/C15H22N2O4/c1-15(2,3)14(20)17-8-11(18)7-16(13(19)10-17)9-12-5-4-6-21-12/h4-6,11,18H,7-10H2,1-3H3 |
| InChIKey | KUAFXJCPWDESJC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one?
The IUPAC name of 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one (CID 118738549) is 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one.
What is the SMILES notation for 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one?
The canonical SMILES for 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one is CC(C)(C)C(=O)N1CC(=O)N(Cc2ccco2)CC(O)C1.
What is the InChIKey of 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one?
The InChIKey is KUAFXJCPWDESJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-15(2,3)14(20)17-8-11(18)7-16(13(19)10-17)9-12-5-4-6-21-12/h4-6,11,18H,7-10H2,1-3H3.
What are the key properties of 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one?
4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one has a molecular weight of 294.35 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpropanoyl)-1-(furan-2-ylmethyl)-6-hydroxy-1,4-diazepan-2-one is sourced from PubChem (CID 118738549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).