C18H24N2O3 — CID 118738589
ethyl (7S,8R,8aS)-2-acetyl-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxylate (PubChem CID 118738589) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl (7S,8R,8aS)-2-acetyl-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxylate.
| Compound Name | ethyl (7S,8R,8aS)-2-acetyl-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxylate |
|---|---|
| PubChem CID | 118738589 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl (7S,8R,8aS)-2-acetyl-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)CN2CCN(C(C)=O)C[C@H]12 |
| InChI | InChI=1S/C18H24N2O3/c1-3-23-18(22)17-15(14-7-5-4-6-8-14)11-20-10-9-19(13(2)21)12-16(17)20/h4-8,15-17H,3,9-12H2,1-2H3/t15-,16-,17-/m1/s1 |
| InChIKey | OFLNYLMCXUHFLI-BRWVUGGUSA-N |
| XLogP | 1.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |