C20H26N2O3 — CID 118738590
ethyl (7S,8R,8aS)-2-(cyclopropanecarbonyl)-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxylate (PubChem CID 118738590) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethyl (7S,8R,8aS)-2-(cyclopropanecarbonyl)-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxylate.
| Compound Name | ethyl (7S,8R,8aS)-2-(cyclopropanecarbonyl)-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxylate |
|---|---|
| PubChem CID | 118738590 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethyl (7S,8R,8aS)-2-(cyclopropanecarbonyl)-7-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)CN2CCN(C(=O)C3CC3)C[C@H]12 |
| InChI | InChI=1S/C20H26N2O3/c1-2-25-20(24)18-16(14-6-4-3-5-7-14)12-21-10-11-22(13-17(18)21)19(23)15-8-9-15/h3-7,15-18H,2,8-13H2,1H3/t16-,17-,18-/m1/s1 |
| InChIKey | CNZQDSDREJHRPK-KZNAEPCWSA-N |
| XLogP | 1.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |