C15H22N2O — CID 118738656
[(7S,8R,8aS)-2-methyl-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]methanol (PubChem CID 118738656) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is [(7S,8R,8aS)-2-methyl-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]methanol.
| Compound Name | [(7S,8R,8aS)-2-methyl-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]methanol |
|---|---|
| PubChem CID | 118738656 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [(7S,8R,8aS)-2-methyl-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]methanol |
| SMILES | CN1CCN2C[C@@H](CO)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C15H22N2O/c1-16-7-8-17-9-13(11-18)15(14(17)10-16)12-5-3-2-4-6-12/h2-6,13-15,18H,7-11H2,1H3/t13-,14+,15-/m0/s1 |
| InChIKey | UYUYDTNRPSSSIA-ZNMIVQPWSA-N |
| XLogP | 1.01 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |