C21H30N2O2 — CID 118738658
1-[(7S,8R,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-cyclopentylethanone (PubChem CID 118738658) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-[(7S,8R,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-cyclopentylethanone.
| Compound Name | 1-[(7S,8R,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 118738658 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-[(7S,8R,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-cyclopentylethanone |
| SMILES | O=C(CC1CCCC1)N1CCN2C[C@@H](CO)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C21H30N2O2/c24-15-18-13-22-10-11-23(20(25)12-16-6-4-5-7-16)14-19(22)21(18)17-8-2-1-3-9-17/h1-3,8-9,16,18-19,21,24H,4-7,10-15H2/t18-,19+,21-/m0/s1 |
| InChIKey | PTFBKOBDSOVWRQ-ZVDOUQERSA-N |
| XLogP | 2.49 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |