C12H18N2O2 — CID 118738741
6-amino-1-(2-methoxyethyl)-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 118738741) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 6-amino-1-(2-methoxyethyl)-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 6-amino-1-(2-methoxyethyl)-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 118738741 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 6-amino-1-(2-methoxyethyl)-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | COCCn1c2c(ccc1=O)CC(N)CC2 |
| InChI | InChI=1S/C12H18N2O2/c1-16-7-6-14-11-4-3-10(13)8-9(11)2-5-12(14)15/h2,5,10H,3-4,6-8,13H2,1H3 |
| InChIKey | BFNBZJNDPVBQQX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |