C13H20N2O — CID 118738743
6-amino-1-(2-methylpropyl)-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 118738743) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-amino-1-(2-methylpropyl)-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 6-amino-1-(2-methylpropyl)-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 118738743 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 6-amino-1-(2-methylpropyl)-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CC(C)Cn1c2c(ccc1=O)CC(N)CC2 |
| InChI | InChI=1S/C13H20N2O/c1-9(2)8-15-12-5-4-11(14)7-10(12)3-6-13(15)16/h3,6,9,11H,4-5,7-8,14H2,1-2H3 |
| InChIKey | GBKGZYCERYCBIP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |