About N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide
N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide (PubChem CID 118738744) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide.
Molecular Properties
| Compound Name | N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide |
| PubChem CID | 118738744 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide |
| SMILES | CC(C)NC(=O)N1CCCC2(CCCCN2)C1 |
| InChI | InChI=1S/C13H25N3O/c1-11(2)15-12(17)16-9-5-7-13(10-16)6-3-4-8-14-13/h11,14H,3-10H2,1-2H3,(H,15,17) |
| InChIKey | JJDDWFLCXUCJPL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide?
The IUPAC name of N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide (CID 118738744) is N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide.
What is the SMILES notation for N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide?
The canonical SMILES for N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide is CC(C)NC(=O)N1CCCC2(CCCCN2)C1.
What is the InChIKey of N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide?
The InChIKey is JJDDWFLCXUCJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-11(2)15-12(17)16-9-5-7-13(10-16)6-3-4-8-14-13/h11,14H,3-10H2,1-2H3,(H,15,17).
What are the key properties of N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide?
N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide has a molecular weight of 239.36 g/mol, XLogP of 1.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-1,8-diazaspiro[5.5]undecane-8-carboxamide is sourced from PubChem (CID 118738744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).