C13H18N4OS — CID 118738887
2-methyl-4-(6,7,8,9-tetrahydro-5H-imidazo[1,2-a][1,4]diazepin-6-ylmethoxymethyl)-1,3-thiazole (PubChem CID 118738887) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-methyl-4-(6,7,8,9-tetrahydro-5H-imidazo[1,2-a][1,4]diazepin-6-ylmethoxymethyl)-1,3-thiazole.
| Compound Name | 2-methyl-4-(6,7,8,9-tetrahydro-5H-imidazo[1,2-a][1,4]diazepin-6-ylmethoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 118738887 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-methyl-4-(6,7,8,9-tetrahydro-5H-imidazo[1,2-a][1,4]diazepin-6-ylmethoxymethyl)-1,3-thiazole |
| SMILES | Cc1nc(COCC2CNCc3nccn3C2)cs1 |
| InChI | InChI=1S/C13H18N4OS/c1-10-16-12(9-19-10)8-18-7-11-4-14-5-13-15-2-3-17(13)6-11/h2-3,9,11,14H,4-8H2,1H3 |
| InChIKey | CEFYNIYSYDXNSF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |