About [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone
[5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone (PubChem CID 118738905) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone |
| PubChem CID | 118738905 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone |
| SMILES | CN(C)c1ccc2c(c1)CN(C(=O)c1ccco1)C2c1cnco1 |
| InChI | InChI=1S/C18H17N3O3/c1-20(2)13-5-6-14-12(8-13)10-21(17(14)16-9-19-11-24-16)18(22)15-4-3-7-23-15/h3-9,11,17H,10H2,1-2H3 |
| InChIKey | RBCJGGSMVHRDDH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone?
The IUPAC name of [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone (CID 118738905) is [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone.
What is the SMILES notation for [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone?
The canonical SMILES for [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone is CN(C)c1ccc2c(c1)CN(C(=O)c1ccco1)C2c1cnco1.
What is the InChIKey of [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone?
The InChIKey is RBCJGGSMVHRDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O3/c1-20(2)13-5-6-14-12(8-13)10-21(17(14)16-9-19-11-24-16)18(22)15-4-3-7-23-15/h3-9,11,17H,10H2,1-2H3.
What are the key properties of [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone?
[5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone has a molecular weight of 323.35 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(dimethylamino)-1-(1,3-oxazol-5-yl)-1,3-dihydroisoindol-2-yl]-(furan-2-yl)methanone is sourced from PubChem (CID 118738905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).