About 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine
4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine (PubChem CID 118738943) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine.
Molecular Properties
| Compound Name | 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine |
| PubChem CID | 118738943 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine |
| SMILES | Cc1ccc2c(c1)C1(CCNCC1)CC2N1CCOCC1 |
| InChI | InChI=1S/C18H26N2O/c1-14-2-3-15-16(12-14)18(4-6-19-7-5-18)13-17(15)20-8-10-21-11-9-20/h2-3,12,17,19H,4-11,13H2,1H3 |
| InChIKey | OICVZJXFMFNBDD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine?
The IUPAC name of 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine (CID 118738943) is 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine.
What is the SMILES notation for 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine?
The canonical SMILES for 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine is Cc1ccc2c(c1)C1(CCNCC1)CC2N1CCOCC1.
What is the InChIKey of 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine?
The InChIKey is OICVZJXFMFNBDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O/c1-14-2-3-15-16(12-14)18(4-6-19-7-5-18)13-17(15)20-8-10-21-11-9-20/h2-3,12,17,19H,4-11,13H2,1H3.
What are the key properties of 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine?
4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine has a molecular weight of 286.42 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)morpholine is sourced from PubChem (CID 118738943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).