About 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane
6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane (PubChem CID 118739006) has the molecular formula C12H16F2N4
and a molecular weight of 254.28 g/mol. Its IUPAC name is 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane |
| PubChem CID | 118739006 |
| Molecular Formula | C12H16F2N4 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane |
| SMILES | FC1(F)CCNCC12CCN(c1ncccn1)C2 |
| InChI | InChI=1S/C12H16F2N4/c13-12(14)2-6-15-8-11(12)3-7-18(9-11)10-16-4-1-5-17-10/h1,4-5,15H,2-3,6-9H2 |
| InChIKey | SAMKBMJSKJFASG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane?
The IUPAC name of 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane (CID 118739006) is 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane?
The canonical SMILES for 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane is FC1(F)CCNCC12CCN(c1ncccn1)C2.
What is the InChIKey of 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane?
The InChIKey is SAMKBMJSKJFASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N4/c13-12(14)2-6-15-8-11(12)3-7-18(9-11)10-16-4-1-5-17-10/h1,4-5,15H,2-3,6-9H2.
What are the key properties of 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane?
6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane has a molecular weight of 254.28 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-difluoro-2-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 118739006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).