C20H28N4O2 — CID 118739097
8-(cyclopent-3-ene-1-carbonyl)-1-ethyl-4-(1-methylpyrazol-4-yl)-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 118739097) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 8-(cyclopent-3-ene-1-carbonyl)-1-ethyl-4-(1-methylpyrazol-4-yl)-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-(cyclopent-3-ene-1-carbonyl)-1-ethyl-4-(1-methylpyrazol-4-yl)-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 118739097 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 8-(cyclopent-3-ene-1-carbonyl)-1-ethyl-4-(1-methylpyrazol-4-yl)-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | CCN1C(=O)CC(c2cnn(C)c2)C12CCN(C(=O)C1CC=CC1)CC2 |
| InChI | InChI=1S/C20H28N4O2/c1-3-24-18(25)12-17(16-13-21-22(2)14-16)20(24)8-10-23(11-9-20)19(26)15-6-4-5-7-15/h4-5,13-15,17H,3,6-12H2,1-2H3 |
| InChIKey | DQVXMOLOSSCTCX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|