About ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate
ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate (PubChem CID 118739098) has the molecular formula C14H21N3O4
and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate |
| PubChem CID | 118739098 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)COC)Cc2ncn(CC)c21 |
| InChI | InChI=1S/C14H21N3O4/c1-4-16-9-15-11-7-17(12(18)8-20-3)6-10(13(11)16)14(19)21-5-2/h9-10H,4-8H2,1-3H3 |
| InChIKey | DLYPTHAELQOLHS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate?
The IUPAC name of ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate (CID 118739098) is ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate.
What is the SMILES notation for ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate?
The canonical SMILES for ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate is CCOC(=O)C1CN(C(=O)COC)Cc2ncn(CC)c21.
What is the InChIKey of ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate?
The InChIKey is DLYPTHAELQOLHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O4/c1-4-16-9-15-11-7-17(12(18)8-20-3)6-10(13(11)16)14(19)21-5-2/h9-10H,4-8H2,1-3H3.
What are the key properties of ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate?
ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate has a molecular weight of 295.34 g/mol, XLogP of 0.54, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethyl-5-(2-methoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-7-carboxylate is sourced from PubChem (CID 118739098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).