About 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one
1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one (PubChem CID 118739171) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one |
| PubChem CID | 118739171 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2ccccc2CC12CCN(CCO)C2 |
| InChI | InChI=1S/C14H18N2O2/c17-8-7-16-6-5-14(10-16)9-11-3-1-2-4-12(11)15-13(14)18/h1-4,17H,5-10H2,(H,15,18) |
| InChIKey | DCXVFWJNKLNABZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one?
The IUPAC name of 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one (CID 118739171) is 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one.
What is the SMILES notation for 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one?
The canonical SMILES for 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one is O=C1Nc2ccccc2CC12CCN(CCO)C2.
What is the InChIKey of 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one?
The InChIKey is DCXVFWJNKLNABZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c17-8-7-16-6-5-14(10-16)9-11-3-1-2-4-12(11)15-13(14)18/h1-4,17H,5-10H2,(H,15,18).
What are the key properties of 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one?
1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one has a molecular weight of 246.31 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(2-hydroxyethyl)spiro[1,4-dihydroquinoline-3,3'-pyrrolidine]-2-one is sourced from PubChem (CID 118739171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).