C18H26N4O2 — CID 118739174
(9-pyrimidin-2-yl-2-oxa-9-azaspiro[5.5]undecan-3-yl)-pyrrolidin-1-ylmethanone (PubChem CID 118739174) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (9-pyrimidin-2-yl-2-oxa-9-azaspiro[5.5]undecan-3-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (9-pyrimidin-2-yl-2-oxa-9-azaspiro[5.5]undecan-3-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 118739174 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (9-pyrimidin-2-yl-2-oxa-9-azaspiro[5.5]undecan-3-yl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CCC2(CCN(c3ncccn3)CC2)CO1)N1CCCC1 |
| InChI | InChI=1S/C18H26N4O2/c23-16(21-10-1-2-11-21)15-4-5-18(14-24-15)6-12-22(13-7-18)17-19-8-3-9-20-17/h3,8-9,15H,1-2,4-7,10-14H2 |
| InChIKey | TYTHZBPHQBKDPD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |