C17H22N8 — CID 118739232
6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-(5-methylpyrimidin-2-yl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine (PubChem CID 118739232) has the molecular formula C17H22N8 and a molecular weight of 338.42 g/mol. Its IUPAC name is 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-(5-methylpyrimidin-2-yl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine.
| Compound Name | 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-(5-methylpyrimidin-2-yl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 118739232 |
| Molecular Formula | C17H22N8 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-8-(5-methylpyrimidin-2-yl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
| SMILES | Cc1cnc(N2Cc3nccn3CC(Cn3nc(C)nc3C)C2)nc1 |
| InChI | InChI=1S/C17H22N8/c1-12-6-19-17(20-7-12)24-9-15(8-23-5-4-18-16(23)11-24)10-25-14(3)21-13(2)22-25/h4-7,15H,8-11H2,1-3H3 |
| InChIKey | NRBIXQKBCLNHBD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |