About (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone
(1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone (PubChem CID 118739236) has the molecular formula C13H19N3O4S
and a molecular weight of 313.38 g/mol. Its IUPAC name is (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone |
| PubChem CID | 118739236 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone |
| SMILES | CS(=O)(=O)N1CCCC12CCCN(C(=O)c1ccno1)C2 |
| InChI | InChI=1S/C13H19N3O4S/c1-21(18,19)16-9-3-6-13(16)5-2-8-15(10-13)12(17)11-4-7-14-20-11/h4,7H,2-3,5-6,8-10H2,1H3 |
| InChIKey | YMLLFNLIYWCNNP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone?
The IUPAC name of (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone (CID 118739236) is (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone.
What is the SMILES notation for (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone?
The canonical SMILES for (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone is CS(=O)(=O)N1CCCC12CCCN(C(=O)c1ccno1)C2.
What is the InChIKey of (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone?
The InChIKey is YMLLFNLIYWCNNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O4S/c1-21(18,19)16-9-3-6-13(16)5-2-8-15(10-13)12(17)11-4-7-14-20-11/h4,7H,2-3,5-6,8-10H2,1H3.
What are the key properties of (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone?
(1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone has a molecular weight of 313.38 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)-(1,2-oxazol-5-yl)methanone is sourced from PubChem (CID 118739236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).