C13H19N7O — CID 118739363
N,N,8-trimethyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide (PubChem CID 118739363) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is N,N,8-trimethyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | N,N,8-trimethyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 118739363 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N,N,8-trimethyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC1c2ncc(Cn3cncn3)n2CCN1C(=O)N(C)C |
| InChI | InChI=1S/C13H19N7O/c1-10-12-15-6-11(7-18-9-14-8-16-18)20(12)5-4-19(10)13(21)17(2)3/h6,8-10H,4-5,7H2,1-3H3 |
| InChIKey | NEWSMZWWFYDTTH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |