C12H19N5O3 — CID 118739372
7-N-(2-methoxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5,7-dicarboxamide (PubChem CID 118739372) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 7-N-(2-methoxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5,7-dicarboxamide.
| Compound Name | 7-N-(2-methoxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 118739372 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 7-N-(2-methoxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5,7-dicarboxamide |
| SMILES | COCCNC(=O)C1CN(C(N)=O)Cc2ccnn2C1 |
| InChI | InChI=1S/C12H19N5O3/c1-20-5-4-14-11(18)9-6-16(12(13)19)8-10-2-3-15-17(10)7-9/h2-3,9H,4-8H2,1H3,(H2,13,19)(H,14,18) |
| InChIKey | HEJGEQFDAWIBBO-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|