C14H22N4O — CID 118739784
8-ethyl-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine (PubChem CID 118739784) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 8-ethyl-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine.
| Compound Name | 8-ethyl-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 118739784 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 8-ethyl-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| SMILES | CCN1CCC2(CC1)CC(Nc1ncccn1)CO2 |
| InChI | InChI=1S/C14H22N4O/c1-2-18-8-4-14(5-9-18)10-12(11-19-14)17-13-15-6-3-7-16-13/h3,6-7,12H,2,4-5,8-11H2,1H3,(H,15,16,17) |
| InChIKey | ODNFAHLZISDPQK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |