C20H23N5 — CID 118739824
(3aR,4R,6aS)-2-(1H-indol-5-ylmethyl)-N-pyridazin-3-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 118739824) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is (3aR,4R,6aS)-2-(1H-indol-5-ylmethyl)-N-pyridazin-3-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4R,6aS)-2-(1H-indol-5-ylmethyl)-N-pyridazin-3-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 118739824 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | (3aR,4R,6aS)-2-(1H-indol-5-ylmethyl)-N-pyridazin-3-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | c1cnnc(N[C@@H]2CC[C@@H]3CN(Cc4ccc5[nH]ccc5c4)C[C@@H]32)c1 |
| InChI | InChI=1S/C20H23N5/c1-2-20(24-22-8-1)23-19-6-4-16-12-25(13-17(16)19)11-14-3-5-18-15(10-14)7-9-21-18/h1-3,5,7-10,16-17,19,21H,4,6,11-13H2,(H,23,24)/t16-,17+,19-/m1/s1 |
| InChIKey | GKZSNVFJANTZFK-ZIFCJYIRSA-N |
| XLogP | 3.28 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |