About (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone
(2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone (PubChem CID 118739825) has the molecular formula C15H15F2N3O2
and a molecular weight of 307.30 g/mol. Its IUPAC name is (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone.
Molecular Properties
| Compound Name | (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone |
| PubChem CID | 118739825 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone |
| SMILES | Cc1cn[nH]c1C1COCCN1C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H15F2N3O2/c1-9-7-18-19-14(9)13-8-22-5-4-20(13)15(21)11-6-10(16)2-3-12(11)17/h2-3,6-7,13H,4-5,8H2,1H3,(H,18,19) |
| InChIKey | LXVVYSIVJWLSHS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone?
The IUPAC name of (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone (CID 118739825) is (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone.
What is the SMILES notation for (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone?
The canonical SMILES for (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone is Cc1cn[nH]c1C1COCCN1C(=O)c1cc(F)ccc1F.
What is the InChIKey of (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone?
The InChIKey is LXVVYSIVJWLSHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2N3O2/c1-9-7-18-19-14(9)13-8-22-5-4-20(13)15(21)11-6-10(16)2-3-12(11)17/h2-3,6-7,13H,4-5,8H2,1H3,(H,18,19).
What are the key properties of (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone?
(2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone has a molecular weight of 307.30 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-difluorophenyl)-[3-(4-methyl-1H-pyrazol-5-yl)morpholin-4-yl]methanone is sourced from PubChem (CID 118739825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).